C20H36N4O3 — CID 153342613
methyl 2-amino-4-[4-[5-ethyl-6-(methylamino)-2-pyridinyl]butyl-(2-methoxyethyl)amino]butanoate (PubChem CID 153342613) has the molecular formula C20H36N4O3 and a molecular weight of 380.53 g/mol. Its IUPAC name is methyl 2-amino-4-[4-[5-ethyl-6-(methylamino)-2-pyridinyl]butyl-(2-methoxyethyl)amino]butanoate.
| Compound Name | methyl 2-amino-4-[4-[5-ethyl-6-(methylamino)-2-pyridinyl]butyl-(2-methoxyethyl)amino]butanoate |
|---|---|
| PubChem CID | 153342613 |
| Molecular Formula | C20H36N4O3 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.28 |
| IUPAC Name | methyl 2-amino-4-[4-[5-ethyl-6-(methylamino)-2-pyridinyl]butyl-(2-methoxyethyl)amino]butanoate |
| SMILES | CCc1ccc(CCCCN(CCOC)CCC(N)C(=O)OC)nc1NC |
| InChI | InChI=1S/C20H36N4O3/c1-5-16-9-10-17(23-19(16)22-2)8-6-7-12-24(14-15-26-3)13-11-18(21)20(25)27-4/h9-10,18H,5-8,11-15,21H2,1-4H3,(H,22,23) |
| InChIKey | DOZYOGFQQCGYIG-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|