C20H37FN2O — CID 176962147
3-ethyl-N-methyl-6-pentylpyridin-2-amine;1-fluoro-2-methoxyhexane (PubChem CID 176962147) has the molecular formula C20H37FN2O and a molecular weight of 340.53 g/mol. Its IUPAC name is 3-ethyl-N-methyl-6-pentylpyridin-2-amine;1-fluoro-2-methoxyhexane.
| Compound Name | 3-ethyl-N-methyl-6-pentylpyridin-2-amine;1-fluoro-2-methoxyhexane |
|---|---|
| PubChem CID | 176962147 |
| Molecular Formula | C20H37FN2O |
| Molecular Weight | 340.53 g/mol |
| Exact Mass | 340.29 |
| IUPAC Name | 3-ethyl-N-methyl-6-pentylpyridin-2-amine;1-fluoro-2-methoxyhexane |
| SMILES | CCCCC(CF)OC.CCCCCc1ccc(CC)c(NC)n1 |
| InChI | InChI=1S/C13H22N2.C7H15FO/c1-4-6-7-8-12-10-9-11(5-2)13(14-3)15-12;1-3-4-5-7(6-8)9-2/h9-10H,4-8H2,1-3H3,(H,14,15);7H,3-6H2,1-2H3 |
| InChIKey | UXZMWNHTOPQZNG-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.53 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|