C8H17F5Si2 — CID 154510768
2-(6,6-difluorohexylsilyl)ethyl-trifluorosilane (PubChem CID 154510768) has the molecular formula C8H17F5Si2 and a molecular weight of 264.39 g/mol. Its IUPAC name is 2-(6,6-difluorohexylsilyl)ethyl-trifluorosilane.
| Compound Name | 2-(6,6-difluorohexylsilyl)ethyl-trifluorosilane |
|---|---|
| PubChem CID | 154510768 |
| Molecular Formula | C8H17F5Si2 |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 2-(6,6-difluorohexylsilyl)ethyl-trifluorosilane |
| SMILES | FC(F)CCCCC[SiH2]CC[Si](F)(F)F |
| InChI | InChI=1S/C8H17F5Si2/c9-8(10)4-2-1-3-5-14-6-7-15(11,12)13/h8H,1-7,14H2 |
| InChIKey | MMJSADIDAJAFNQ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|