C5H9ClF5N — CID 138606782
1,1,3,4,5-pentafluoropentan-2-amine;hydrochloride (PubChem CID 138606782) has the molecular formula C5H9ClF5N and a molecular weight of 213.58 g/mol. Its IUPAC name is 1,1,3,4,5-pentafluoropentan-2-amine;hydrochloride.
| Compound Name | 1,1,3,4,5-pentafluoropentan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 138606782 |
| Molecular Formula | C5H9ClF5N |
| Molecular Weight | 213.58 g/mol |
| Exact Mass | 213.03 |
| IUPAC Name | 1,1,3,4,5-pentafluoropentan-2-amine;hydrochloride |
| SMILES | Cl.NC(C(F)F)C(F)C(F)CF |
| InChI | InChI=1S/C5H8F5N.ClH/c6-1-2(7)3(8)4(11)5(9)10;/h2-5H,1,11H2;1H |
| InChIKey | WVISSPSSKAWSDD-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.58 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |