C4H7F3S — CID 139415886
1,2,4-trifluorobutane-1-thiol (PubChem CID 139415886) has the molecular formula C4H7F3S and a molecular weight of 144.16 g/mol. Its IUPAC name is 1,2,4-trifluorobutane-1-thiol.
| Compound Name | 1,2,4-trifluorobutane-1-thiol |
|---|---|
| PubChem CID | 139415886 |
| Molecular Formula | C4H7F3S |
| Molecular Weight | 144.16 g/mol |
| Exact Mass | 144.02 |
| IUPAC Name | 1,2,4-trifluorobutane-1-thiol |
| SMILES | FCCC(F)C(F)S |
| InChI | InChI=1S/C4H7F3S/c5-2-1-3(6)4(7)8/h3-4,8H,1-2H2 |
| InChIKey | ZBTQSSZQIAFGTM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.16 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|