About 1-bromo-2,4-difluorobutane
1-bromo-2,4-difluorobutane (PubChem CID 84654528) has the molecular formula C4H7BrF2
and a molecular weight of 173.00 g/mol. Its IUPAC name is 1-bromo-2,4-difluorobutane.
Molecular Properties
| Compound Name | 1-bromo-2,4-difluorobutane |
| PubChem CID | 84654528 |
| Molecular Formula | C4H7BrF2 |
| Molecular Weight | 173.00 g/mol |
| Exact Mass | 171.97 |
| IUPAC Name | 1-bromo-2,4-difluorobutane |
| SMILES | FCCC(F)CBr |
| InChI | InChI=1S/C4H7BrF2/c5-3-4(7)1-2-6/h4H,1-3H2 |
| InChIKey | MLBJSOODANBBNU-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.00 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-2,4-difluorobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2,4-difluorobutane?
The IUPAC name of 1-bromo-2,4-difluorobutane (CID 84654528) is 1-bromo-2,4-difluorobutane.
What is the SMILES notation for 1-bromo-2,4-difluorobutane?
The canonical SMILES for 1-bromo-2,4-difluorobutane is FCCC(F)CBr.
What is the InChIKey of 1-bromo-2,4-difluorobutane?
The InChIKey is MLBJSOODANBBNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7BrF2/c5-3-4(7)1-2-6/h4H,1-3H2.
What are the key properties of 1-bromo-2,4-difluorobutane?
1-bromo-2,4-difluorobutane has a molecular weight of 173.00 g/mol, XLogP of 2.08, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2,4-difluorobutane is sourced from PubChem (CID 84654528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).