C4H5F2N — CID 175233038
2,4-difluorobutanenitrile (PubChem CID 175233038) has the molecular formula C4H5F2N and a molecular weight of 105.09 g/mol. Its IUPAC name is 2,4-difluorobutanenitrile.
| Compound Name | 2,4-difluorobutanenitrile |
|---|---|
| PubChem CID | 175233038 |
| Molecular Formula | C4H5F2N |
| Molecular Weight | 105.09 g/mol |
| Exact Mass | 105.04 |
| IUPAC Name | 2,4-difluorobutanenitrile |
| SMILES | N#CC(F)CCF |
| InChI | InChI=1S/C4H5F2N/c5-2-1-4(6)3-7/h4H,1-2H2 |
| InChIKey | GACHGCJDBBAXEM-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 105.09 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |