C14H22F5NO — CID 175318333
2-(2,3,4,5,8-pentafluorooctoxy)hexanenitrile (PubChem CID 175318333) has the molecular formula C14H22F5NO and a molecular weight of 315.33 g/mol. Its IUPAC name is 2-(2,3,4,5,8-pentafluorooctoxy)hexanenitrile.
| Compound Name | 2-(2,3,4,5,8-pentafluorooctoxy)hexanenitrile |
|---|---|
| PubChem CID | 175318333 |
| Molecular Formula | C14H22F5NO |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 2-(2,3,4,5,8-pentafluorooctoxy)hexanenitrile |
| SMILES | CCCCC(C#N)OCC(F)C(F)C(F)C(F)CCCF |
| InChI | InChI=1S/C14H22F5NO/c1-2-3-5-10(8-20)21-9-12(17)14(19)13(18)11(16)6-4-7-15/h10-14H,2-7,9H2,1H3 |
| InChIKey | PPCILDYULSTNRZ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |