C12H16F10 — CID 162611334
1,1,1,2,3,4,5,6,7,8-decafluorododecane (PubChem CID 162611334) has the molecular formula C12H16F10 and a molecular weight of 350.24 g/mol. Its IUPAC name is 1,1,1,2,3,4,5,6,7,8-decafluorododecane.
| Compound Name | 1,1,1,2,3,4,5,6,7,8-decafluorododecane |
|---|---|
| PubChem CID | 162611334 |
| Molecular Formula | C12H16F10 |
| Molecular Weight | 350.24 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 1,1,1,2,3,4,5,6,7,8-decafluorododecane |
| SMILES | CCCCC(F)C(F)C(F)C(F)C(F)C(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C12H16F10/c1-2-3-4-5(13)6(14)7(15)8(16)9(17)10(18)11(19)12(20,21)22/h5-11H,2-4H2,1H3 |
| InChIKey | BWDOPYZTINOWON-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.24 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |