C9H17F3 — CID 102212838
(2R,3S,4R)-2,3,4-trifluorononane (PubChem CID 102212838) has the molecular formula C9H17F3 and a molecular weight of 182.23 g/mol. Its IUPAC name is (2R,3S,4R)-2,3,4-trifluorononane.
| Compound Name | (2R,3S,4R)-2,3,4-trifluorononane |
|---|---|
| PubChem CID | 102212838 |
| Molecular Formula | C9H17F3 |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (2R,3S,4R)-2,3,4-trifluorononane |
| SMILES | CCCCC[C@@H](F)[C@@H](F)[C@@H](C)F |
| InChI | InChI=1S/C9H17F3/c1-3-4-5-6-8(11)9(12)7(2)10/h7-9H,3-6H2,1-2H3/t7-,8-,9+/m1/s1 |
| InChIKey | ADXHCRXVUABNRZ-HLTSFMKQSA-N |
| XLogP | 3.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|