C5H7ClF4 — CID 156540413
3-chloro-1,1,2,5-tetrafluoropentane (PubChem CID 156540413) has the molecular formula C5H7ClF4 and a molecular weight of 178.56 g/mol. Its IUPAC name is 3-chloro-1,1,2,5-tetrafluoropentane.
| Compound Name | 3-chloro-1,1,2,5-tetrafluoropentane |
|---|---|
| PubChem CID | 156540413 |
| Molecular Formula | C5H7ClF4 |
| Molecular Weight | 178.56 g/mol |
| Exact Mass | 178.02 |
| IUPAC Name | 3-chloro-1,1,2,5-tetrafluoropentane |
| SMILES | FCCC(Cl)C(F)C(F)F |
| InChI | InChI=1S/C5H7ClF4/c6-3(1-2-7)4(8)5(9)10/h3-5H,1-2H2 |
| InChIKey | IUHRVQCXHRTTCD-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.56 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|