C4H6Cl2F2 — CID 55301115
(2S,3R)-1,3-dichloro-2,4-difluorobutane (PubChem CID 55301115) has the molecular formula C4H6Cl2F2 and a molecular weight of 162.99 g/mol. Its IUPAC name is (2S,3R)-1,3-dichloro-2,4-difluorobutane.
| Compound Name | (2S,3R)-1,3-dichloro-2,4-difluorobutane |
|---|---|
| PubChem CID | 55301115 |
| Molecular Formula | C4H6Cl2F2 |
| Molecular Weight | 162.99 g/mol |
| Exact Mass | 161.98 |
| IUPAC Name | (2S,3R)-1,3-dichloro-2,4-difluorobutane |
| SMILES | FC[C@@H](Cl)[C@@H](F)CCl |
| InChI | InChI=1S/C4H6Cl2F2/c5-1-4(8)3(6)2-7/h3-4H,1-2H2/t3-,4+/m1/s1 |
| InChIKey | DMJQGNFQJVCOJI-DMTCNVIQSA-N |
| XLogP | 2.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.99 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|