C5H11F2N — CID 147861140
2,4-difluoro-N-methylbutan-1-amine (PubChem CID 147861140) has the molecular formula C5H11F2N and a molecular weight of 123.15 g/mol. Its IUPAC name is 2,4-difluoro-N-methylbutan-1-amine.
| Compound Name | 2,4-difluoro-N-methylbutan-1-amine |
|---|---|
| PubChem CID | 147861140 |
| Molecular Formula | C5H11F2N |
| Molecular Weight | 123.15 g/mol |
| Exact Mass | 123.09 |
| IUPAC Name | 2,4-difluoro-N-methylbutan-1-amine |
| SMILES | CNCC(F)CCF |
| InChI | InChI=1S/C5H11F2N/c1-8-4-5(7)2-3-6/h5,8H,2-4H2,1H3 |
| InChIKey | HWSNVDLRILOICR-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.15 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |