C8H17ClFN — CID 122239914
2-fluoro-N,5-dimethylhex-4-en-1-amine;hydrochloride (PubChem CID 122239914) has the molecular formula C8H17ClFN and a molecular weight of 181.68 g/mol. Its IUPAC name is 2-fluoro-N,5-dimethylhex-4-en-1-amine;hydrochloride.
| Compound Name | 2-fluoro-N,5-dimethylhex-4-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 122239914 |
| Molecular Formula | C8H17ClFN |
| Molecular Weight | 181.68 g/mol |
| Exact Mass | 181.10 |
| IUPAC Name | 2-fluoro-N,5-dimethylhex-4-en-1-amine;hydrochloride |
| SMILES | CNCC(F)CC=C(C)C.Cl |
| InChI | InChI=1S/C8H16FN.ClH/c1-7(2)4-5-8(9)6-10-3;/h4,8,10H,5-6H2,1-3H3;1H |
| InChIKey | UPYFUOBYSFRRIH-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.68 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|