C8H18FN — CID 129462625
(2S)-2-fluoro-N,5-dimethylhexan-1-amine (PubChem CID 129462625) has the molecular formula C8H18FN and a molecular weight of 147.24 g/mol. Its IUPAC name is (2S)-2-fluoro-N,5-dimethylhexan-1-amine.
| Compound Name | (2S)-2-fluoro-N,5-dimethylhexan-1-amine |
|---|---|
| PubChem CID | 129462625 |
| Molecular Formula | C8H18FN |
| Molecular Weight | 147.24 g/mol |
| Exact Mass | 147.14 |
| IUPAC Name | (2S)-2-fluoro-N,5-dimethylhexan-1-amine |
| SMILES | CNC[C@@H](F)CCC(C)C |
| InChI | InChI=1S/C8H18FN/c1-7(2)4-5-8(9)6-10-3/h7-8,10H,4-6H2,1-3H3/t8-/m0/s1 |
| InChIKey | CUIZTKMGNGWEFD-QMMMGPOBSA-N |
| XLogP | 1.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.24 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |