C5H6F3N — CID 84762482
4,5,5-trifluoropentanenitrile (PubChem CID 84762482) has the molecular formula C5H6F3N and a molecular weight of 137.10 g/mol. Its IUPAC name is 4,5,5-trifluoropentanenitrile.
| Compound Name | 4,5,5-trifluoropentanenitrile |
|---|---|
| PubChem CID | 84762482 |
| Molecular Formula | C5H6F3N |
| Molecular Weight | 137.10 g/mol |
| Exact Mass | 137.05 |
| IUPAC Name | 4,5,5-trifluoropentanenitrile |
| SMILES | N#CCCC(F)C(F)F |
| InChI | InChI=1S/C5H6F3N/c6-4(5(7)8)2-1-3-9/h4-5H,1-2H2 |
| InChIKey | WXXJZBURVAEEEI-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.10 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |