C5H13FN2 — CID 115011093
3-fluoropentane-1,5-diamine (PubChem CID 115011093) has the molecular formula C5H13FN2 and a molecular weight of 120.17 g/mol. Its IUPAC name is 3-fluoropentane-1,5-diamine.
| Compound Name | 3-fluoropentane-1,5-diamine |
|---|---|
| PubChem CID | 115011093 |
| Molecular Formula | C5H13FN2 |
| Molecular Weight | 120.17 g/mol |
| Exact Mass | 120.11 |
| IUPAC Name | 3-fluoropentane-1,5-diamine |
| SMILES | NCCC(F)CCN |
| InChI | InChI=1S/C5H13FN2/c6-5(1-3-7)2-4-8/h5H,1-4,7-8H2 |
| InChIKey | LGICJEFMIXNCBC-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.17 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |