C4H6F3NO — CID 23290112
N,2,4-trifluorobutanamide (PubChem CID 23290112) has the molecular formula C4H6F3NO and a molecular weight of 141.09 g/mol. Its IUPAC name is N,2,4-trifluorobutanamide.
| Compound Name | N,2,4-trifluorobutanamide |
|---|---|
| PubChem CID | 23290112 |
| Molecular Formula | C4H6F3NO |
| Molecular Weight | 141.09 g/mol |
| Exact Mass | 141.04 |
| IUPAC Name | N,2,4-trifluorobutanamide |
| SMILES | O=C(NF)C(F)CCF |
| InChI | InChI=1S/C4H6F3NO/c5-2-1-3(6)4(9)8-7/h3H,1-2H2,(H,8,9) |
| InChIKey | SWUVLYZQPLHYEK-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.09 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|