C8H11F5O — CID 175417573
2,4,5,6,8-pentafluorooctan-3-one (PubChem CID 175417573) has the molecular formula C8H11F5O and a molecular weight of 218.16 g/mol. Its IUPAC name is 2,4,5,6,8-pentafluorooctan-3-one.
| Compound Name | 2,4,5,6,8-pentafluorooctan-3-one |
|---|---|
| PubChem CID | 175417573 |
| Molecular Formula | C8H11F5O |
| Molecular Weight | 218.16 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 2,4,5,6,8-pentafluorooctan-3-one |
| SMILES | CC(F)C(=O)C(F)C(F)C(F)CCF |
| InChI | InChI=1S/C8H11F5O/c1-4(10)8(14)7(13)6(12)5(11)2-3-9/h4-7H,2-3H2,1H3 |
| InChIKey | DDRLNEMXGCOFKC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.16 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |