C18H29F9O3S — CID 175529274
3,4-diethyl-5,6,7,8,9,10,11,12,14-nonafluorotetradecane-3-sulfonic acid (PubChem CID 175529274) has the molecular formula C18H29F9O3S and a molecular weight of 496.48 g/mol. Its IUPAC name is 3,4-diethyl-5,6,7,8,9,10,11,12,14-nonafluorotetradecane-3-sulfonic acid.
| Compound Name | 3,4-diethyl-5,6,7,8,9,10,11,12,14-nonafluorotetradecane-3-sulfonic acid |
|---|---|
| PubChem CID | 175529274 |
| Molecular Formula | C18H29F9O3S |
| Molecular Weight | 496.48 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | 3,4-diethyl-5,6,7,8,9,10,11,12,14-nonafluorotetradecane-3-sulfonic acid |
| SMILES | CCC(C(F)C(F)C(F)C(F)C(F)C(F)C(F)C(F)CCF)C(CC)(CC)S(=O)(=O)O |
| InChI | InChI=1S/C18H29F9O3S/c1-4-9(18(5-2,6-3)31(28,29)30)11(21)13(23)15(25)17(27)16(26)14(24)12(22)10(20)7-8-19/h9-17H,4-8H2,1-3H3,(H,28,29,30) |
| InChIKey | FTHMRXLCIINNGN-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.48 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|