C23H33F5N2O — CID 142903426
[(Z)-1-(4-ethylphenyl)-4,5,5,5-tetrafluoropent-1-enyl]hydrazine;fluoromethane;(3Z,5Z)-2-methoxy-5-methylhepta-1,3,5-triene (PubChem CID 142903426) has the molecular formula C23H33F5N2O and a molecular weight of 448.52 g/mol. Its IUPAC name is [(Z)-1-(4-ethylphenyl)-4,5,5,5-tetrafluoropent-1-enyl]hydrazine;fluoromethane;(3Z,5Z)-2-methoxy-5-methylhepta-1,3,5-triene.
| Compound Name | [(Z)-1-(4-ethylphenyl)-4,5,5,5-tetrafluoropent-1-enyl]hydrazine;fluoromethane;(3Z,5Z)-2-methoxy-5-methylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 142903426 |
| Molecular Formula | C23H33F5N2O |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | [(Z)-1-(4-ethylphenyl)-4,5,5,5-tetrafluoropent-1-enyl]hydrazine;fluoromethane;(3Z,5Z)-2-methoxy-5-methylhepta-1,3,5-triene |
| SMILES | C=C(/C=C\C(C)=C/C)OC.CCc1ccc(/C(=C/CC(F)C(F)(F)F)NN)cc1.CF |
| InChI | InChI=1S/C13H16F4N2.C9H14O.CH3F/c1-2-9-3-5-10(6-4-9)11(19-18)7-8-12(14)13(15,16)17;1-5-8(2)6-7-9(3)10-4;1-2/h3-7,12,19H,2,8,18H2,1H3;5-7H,3H2,1-2,4H3;1H3/b11-7-;7-6-,8-5-; |
| InChIKey | RGHWUDXUNXGJIM-DQAGHXBOSA-N |
| XLogP | 6.60 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|