C10H13F3O — CID 143559913
(3Z)-2-methyl-5-(3,3,3-trifluoropropoxy)hexa-1,3,5-triene (PubChem CID 143559913) has the molecular formula C10H13F3O and a molecular weight of 206.21 g/mol. Its IUPAC name is (3Z)-2-methyl-5-(3,3,3-trifluoropropoxy)hexa-1,3,5-triene.
| Compound Name | (3Z)-2-methyl-5-(3,3,3-trifluoropropoxy)hexa-1,3,5-triene |
|---|---|
| PubChem CID | 143559913 |
| Molecular Formula | C10H13F3O |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | (3Z)-2-methyl-5-(3,3,3-trifluoropropoxy)hexa-1,3,5-triene |
| SMILES | C=C(C)/C=C\C(=C)OCCC(F)(F)F |
| InChI | InChI=1S/C10H13F3O/c1-8(2)4-5-9(3)14-7-6-10(11,12)13/h4-5H,1,3,6-7H2,2H3/b5-4- |
| InChIKey | MNPMNYSSGKCECY-PLNGDYQASA-N |
| XLogP | 3.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|