C16H27N2O2Ru — CID 171071118
2-[methyl-[2-[methyl-[3-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxypropyl]amino]ethyl]amino]ethanone;ruthenium(1+) (PubChem CID 171071118) has the molecular formula C16H27N2O2Ru and a molecular weight of 380.47 g/mol. Its IUPAC name is 2-[methyl-[2-[methyl-[3-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxypropyl]amino]ethyl]amino]ethanone;ruthenium(1+).
| Compound Name | 2-[methyl-[2-[methyl-[3-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxypropyl]amino]ethyl]amino]ethanone;ruthenium(1+) |
|---|---|
| PubChem CID | 171071118 |
| Molecular Formula | C16H27N2O2Ru |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 2-[methyl-[2-[methyl-[3-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxypropyl]amino]ethyl]amino]ethanone;ruthenium(1+) |
| SMILES | C=C(C)/C=C\C(=C)OCCCN(C)CCN(C)C[C-]=O.[Ru+] |
| InChI | InChI=1S/C16H27N2O2.Ru/c1-15(2)7-8-16(3)20-14-6-9-17(4)10-11-18(5)12-13-19;/h7-8H,1,3,6,9-12,14H2,2,4-5H3;/q-1;+1/b8-7-; |
| InChIKey | KTOZCIMOOIHMRU-CFYXSCKTSA-N |
| XLogP | 2.01 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|