C15H25FO2 — CID 144978960
(3Z)-2-(3-fluoropropoxy)-5-methylidene-6-(2-methylpropoxy)hepta-1,3-diene (PubChem CID 144978960) has the molecular formula C15H25FO2 and a molecular weight of 256.36 g/mol. Its IUPAC name is (3Z)-2-(3-fluoropropoxy)-5-methylidene-6-(2-methylpropoxy)hepta-1,3-diene.
| Compound Name | (3Z)-2-(3-fluoropropoxy)-5-methylidene-6-(2-methylpropoxy)hepta-1,3-diene |
|---|---|
| PubChem CID | 144978960 |
| Molecular Formula | C15H25FO2 |
| Molecular Weight | 256.36 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | (3Z)-2-(3-fluoropropoxy)-5-methylidene-6-(2-methylpropoxy)hepta-1,3-diene |
| SMILES | C=C(/C=C\C(=C)C(C)OCC(C)C)OCCCF |
| InChI | InChI=1S/C15H25FO2/c1-12(2)11-18-15(5)13(3)7-8-14(4)17-10-6-9-16/h7-8,12,15H,3-4,6,9-11H2,1-2,5H3/b8-7- |
| InChIKey | DBIFOXISKPSJNI-FPLPWBNLSA-N |
| XLogP | 4.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.36 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|