C7H10FNO — CID 123946741
N-[3-(2-fluoroethoxy)buta-1,3-dienyl]methanimine (PubChem CID 123946741) has the molecular formula C7H10FNO and a molecular weight of 143.16 g/mol. Its IUPAC name is N-[3-(2-fluoroethoxy)buta-1,3-dienyl]methanimine.
| Compound Name | N-[3-(2-fluoroethoxy)buta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 123946741 |
| Molecular Formula | C7H10FNO |
| Molecular Weight | 143.16 g/mol |
| Exact Mass | 143.07 |
| IUPAC Name | N-[3-(2-fluoroethoxy)buta-1,3-dienyl]methanimine |
| SMILES | C=NC=CC(=C)OCCF |
| InChI | InChI=1S/C7H10FNO/c1-7(3-5-9-2)10-6-4-8/h3,5H,1-2,4,6H2 |
| InChIKey | KVNJUUCNPKXICB-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.16 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|