C17H19FN2O2 — CID 130329420
(E)-N-[(3E,5Z)-2-(2-fluoroethoxy)hepta-1,3,5-trien-4-yl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 130329420) has the molecular formula C17H19FN2O2 and a molecular weight of 302.35 g/mol. Its IUPAC name is (E)-N-[(3E,5Z)-2-(2-fluoroethoxy)hepta-1,3,5-trien-4-yl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-N-[(3E,5Z)-2-(2-fluoroethoxy)hepta-1,3,5-trien-4-yl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 130329420 |
| Molecular Formula | C17H19FN2O2 |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | (E)-N-[(3E,5Z)-2-(2-fluoroethoxy)hepta-1,3,5-trien-4-yl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | C=C(/C=C(\C=C/C)NC(=O)/C=C/c1cccnc1)OCCF |
| InChI | InChI=1S/C17H19FN2O2/c1-3-5-16(12-14(2)22-11-9-18)20-17(21)8-7-15-6-4-10-19-13-15/h3-8,10,12-13H,2,9,11H2,1H3,(H,20,21)/b5-3-,8-7+,16-12+ |
| InChIKey | OSMGICQMXGNSFL-WLLWJARFSA-N |
| XLogP | 3.17 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|