C11H19ClO — CID 145103825
(3Z)-2-chloro-5-propoxyhexa-1,3,5-triene;ethane (PubChem CID 145103825) has the molecular formula C11H19ClO and a molecular weight of 202.72 g/mol. Its IUPAC name is (3Z)-2-chloro-5-propoxyhexa-1,3,5-triene;ethane.
| Compound Name | (3Z)-2-chloro-5-propoxyhexa-1,3,5-triene;ethane |
|---|---|
| PubChem CID | 145103825 |
| Molecular Formula | C11H19ClO |
| Molecular Weight | 202.72 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | (3Z)-2-chloro-5-propoxyhexa-1,3,5-triene;ethane |
| SMILES | C=C(Cl)/C=C\C(=C)OCCC.CC |
| InChI | InChI=1S/C9H13ClO.C2H6/c1-4-7-11-9(3)6-5-8(2)10;1-2/h5-6H,2-4,7H2,1H3;1-2H3/b6-5-; |
| InChIKey | GSDIMAQEYVKTRX-YSMBQZINSA-N |
| XLogP | 4.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.72 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|