C7H10O3 — CID 57246657
4-ethoxypenta-2,4-dienoic acid (PubChem CID 57246657) has the molecular formula C7H10O3 and a molecular weight of 142.15 g/mol. Its IUPAC name is 4-ethoxypenta-2,4-dienoic acid.
| Compound Name | 4-ethoxypenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 57246657 |
| Molecular Formula | C7H10O3 |
| Molecular Weight | 142.15 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | 4-ethoxypenta-2,4-dienoic acid |
| SMILES | C=C(C=CC(=O)O)OCC |
| InChI | InChI=1S/C7H10O3/c1-3-10-6(2)4-5-7(8)9/h4-5H,2-3H2,1H3,(H,8,9) |
| InChIKey | IVZUEAJDCWZRRZ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.15 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|