C12H20O — CID 143084767
(3Z)-2-methyl-5-(2-methylbutoxy)hexa-1,3,5-triene (PubChem CID 143084767) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is (3Z)-2-methyl-5-(2-methylbutoxy)hexa-1,3,5-triene.
| Compound Name | (3Z)-2-methyl-5-(2-methylbutoxy)hexa-1,3,5-triene |
|---|---|
| PubChem CID | 143084767 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | (3Z)-2-methyl-5-(2-methylbutoxy)hexa-1,3,5-triene |
| SMILES | C=C(C)/C=C\C(=C)OCC(C)CC |
| InChI | InChI=1S/C12H20O/c1-6-11(4)9-13-12(5)8-7-10(2)3/h7-8,11H,2,5-6,9H2,1,3-4H3/b8-7- |
| InChIKey | RDXHMQOKXUYTRJ-FPLPWBNLSA-N |
| XLogP | 3.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|