C11H17NO — CID 89364330
(1Z,3Z,6E)-8-ethoxy-5-methylideneocta-1,3,6-trien-1-amine (PubChem CID 89364330) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is (1Z,3Z,6E)-8-ethoxy-5-methylideneocta-1,3,6-trien-1-amine.
| Compound Name | (1Z,3Z,6E)-8-ethoxy-5-methylideneocta-1,3,6-trien-1-amine |
|---|---|
| PubChem CID | 89364330 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | (1Z,3Z,6E)-8-ethoxy-5-methylideneocta-1,3,6-trien-1-amine |
| SMILES | C=C(/C=C\C=C/N)/C=C/COCC |
| InChI | InChI=1S/C11H17NO/c1-3-13-10-6-8-11(2)7-4-5-9-12/h4-9H,2-3,10,12H2,1H3/b7-4-,8-6+,9-5- |
| InChIKey | CXEHTVHKXKVUJJ-MRRKOCEYSA-N |
| XLogP | 2.16 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|