C14H28N2 — CID 143071611
N'-buta-1,3-dien-2-yl-N'-ethyl-N-hexylethane-1,2-diamine (PubChem CID 143071611) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is N'-buta-1,3-dien-2-yl-N'-ethyl-N-hexylethane-1,2-diamine.
| Compound Name | N'-buta-1,3-dien-2-yl-N'-ethyl-N-hexylethane-1,2-diamine |
|---|---|
| PubChem CID | 143071611 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | N'-buta-1,3-dien-2-yl-N'-ethyl-N-hexylethane-1,2-diamine |
| SMILES | C=CC(=C)N(CC)CCNCCCCCC |
| InChI | InChI=1S/C14H28N2/c1-5-8-9-10-11-15-12-13-16(7-3)14(4)6-2/h6,15H,2,4-5,7-13H2,1,3H3 |
| InChIKey | WJUBDNSCJABWFF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|