C20H37NO3 — CID 171651399
[2-oxo-2-(tetradecylamino)ethyl] 2-methylprop-2-enoate (PubChem CID 171651399) has the molecular formula C20H37NO3 and a molecular weight of 339.52 g/mol. Its IUPAC name is [2-oxo-2-(tetradecylamino)ethyl] 2-methylprop-2-enoate.
| Compound Name | [2-oxo-2-(tetradecylamino)ethyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 171651399 |
| Molecular Formula | C20H37NO3 |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.28 |
| IUPAC Name | [2-oxo-2-(tetradecylamino)ethyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(=O)NCCCCCCCCCCCCCC |
| InChI | InChI=1S/C20H37NO3/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-21-19(22)17-24-20(23)18(2)3/h2,4-17H2,1,3H3,(H,21,22) |
| InChIKey | LAJOXJFTAIPASN-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|