C11H21N — CID 143217992
(2E,4Z)-N-ethyl-7-methylocta-2,4-dien-3-amine (PubChem CID 143217992) has the molecular formula C11H21N and a molecular weight of 167.30 g/mol. Its IUPAC name is (2E,4Z)-N-ethyl-7-methylocta-2,4-dien-3-amine.
| Compound Name | (2E,4Z)-N-ethyl-7-methylocta-2,4-dien-3-amine |
|---|---|
| PubChem CID | 143217992 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | (2E,4Z)-N-ethyl-7-methylocta-2,4-dien-3-amine |
| SMILES | C/C=C(\C=C/CC(C)C)NCC |
| InChI | InChI=1S/C11H21N/c1-5-11(12-6-2)9-7-8-10(3)4/h5,7,9-10,12H,6,8H2,1-4H3/b9-7-,11-5+ |
| InChIKey | GBGPEPISNVHBHA-QSTITTEPSA-N |
| XLogP | 3.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|