C11H21N3 — CID 142271577
acetonitrile;1-N'-[(2E)-2-ethenylpenta-2,4-dienyl]ethene-1,1-diamine;molecular hydrogen (PubChem CID 142271577) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is acetonitrile;1-N'-[(2E)-2-ethenylpenta-2,4-dienyl]ethene-1,1-diamine;molecular hydrogen.
| Compound Name | acetonitrile;1-N'-[(2E)-2-ethenylpenta-2,4-dienyl]ethene-1,1-diamine;molecular hydrogen |
|---|---|
| PubChem CID | 142271577 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | acetonitrile;1-N'-[(2E)-2-ethenylpenta-2,4-dienyl]ethene-1,1-diamine;molecular hydrogen |
| SMILES | C=C/C=C(\C=C)CNC(=C)N.CC#N.[H][H].[H][H] |
| InChI | InChI=1S/C9H14N2.C2H3N.2H2/c1-4-6-9(5-2)7-11-8(3)10;1-2-3;;/h4-6,11H,1-3,7,10H2;1H3;2*1H/b9-6+;;; |
| InChIKey | KTHXVRLLMUFHKG-HCRDSFAKSA-N |
| XLogP | 2.33 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|