C15H26N4 — CID 176544363
(Z)-3-amino-4-methyl-N-[2-(4-methylpenta-1,3-dien-3-ylimino)propyl]pent-2-enimidamide (PubChem CID 176544363) has the molecular formula C15H26N4 and a molecular weight of 262.40 g/mol. Its IUPAC name is (Z)-3-amino-4-methyl-N-[2-(4-methylpenta-1,3-dien-3-ylimino)propyl]pent-2-enimidamide.
| Compound Name | (Z)-3-amino-4-methyl-N-[2-(4-methylpenta-1,3-dien-3-ylimino)propyl]pent-2-enimidamide |
|---|---|
| PubChem CID | 176544363 |
| Molecular Formula | C15H26N4 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.22 |
| IUPAC Name | (Z)-3-amino-4-methyl-N-[2-(4-methylpenta-1,3-dien-3-ylimino)propyl]pent-2-enimidamide |
| SMILES | [H]/N=C(/C=C(\N)C(C)C)NC/C(C)=N/C(C=C)=C(C)C |
| InChI | InChI=1S/C15H26N4/c1-7-14(11(4)5)19-12(6)9-18-15(17)8-13(16)10(2)3/h7-8,10H,1,9,16H2,2-6H3,(H2,17,18)/b13-8-,19-12+ |
| InChIKey | IASKSRYEPXKSKP-OEUDRACKSA-N |
| XLogP | 2.99 |
| TPSA | 74.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|