C8H17ClN4S — CID 176518910
prop-2-enyl N-carbamimidoyl-N'-propan-2-ylcarbamimidothioate;hydrochloride (PubChem CID 176518910) has the molecular formula C8H17ClN4S and a molecular weight of 236.77 g/mol. Its IUPAC name is prop-2-enyl N-carbamimidoyl-N'-propan-2-ylcarbamimidothioate;hydrochloride.
| Compound Name | prop-2-enyl N-carbamimidoyl-N'-propan-2-ylcarbamimidothioate;hydrochloride |
|---|---|
| PubChem CID | 176518910 |
| Molecular Formula | C8H17ClN4S |
| Molecular Weight | 236.77 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | prop-2-enyl N-carbamimidoyl-N'-propan-2-ylcarbamimidothioate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)N/C(=N/C(C)C)SCC=C |
| InChI | InChI=1S/C8H16N4S.ClH/c1-4-5-13-8(11-6(2)3)12-7(9)10;/h4,6H,1,5H2,2-3H3,(H4,9,10,11,12);1H |
| InChIKey | GTMXYNQPPOYVGV-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 74.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.77 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|