About prop-2-enyl N'-propylcarbamimidothioate;hydrochloride
prop-2-enyl N'-propylcarbamimidothioate;hydrochloride (PubChem CID 130978662) has the molecular formula C7H15ClN2S
and a molecular weight of 194.73 g/mol. Its IUPAC name is prop-2-enyl N'-propylcarbamimidothioate;hydrochloride.
Molecular Properties
| Compound Name | prop-2-enyl N'-propylcarbamimidothioate;hydrochloride |
| PubChem CID | 130978662 |
| Molecular Formula | C7H15ClN2S |
| Molecular Weight | 194.73 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | prop-2-enyl N'-propylcarbamimidothioate;hydrochloride |
| SMILES | C=CCS/C(N)=N\CCC.Cl |
| InChI | InChI=1S/C7H14N2S.ClH/c1-3-5-9-7(8)10-6-4-2;/h4H,2-3,5-6H2,1H3,(H2,8,9);1H |
| InChIKey | WUQMZGNAFVZOKI-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.73 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl N'-propylcarbamimidothioate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl N'-propylcarbamimidothioate;hydrochloride?
The IUPAC name of prop-2-enyl N'-propylcarbamimidothioate;hydrochloride (CID 130978662) is prop-2-enyl N'-propylcarbamimidothioate;hydrochloride.
What is the SMILES notation for prop-2-enyl N'-propylcarbamimidothioate;hydrochloride?
The canonical SMILES for prop-2-enyl N'-propylcarbamimidothioate;hydrochloride is C=CCS/C(N)=N\CCC.Cl.
What is the InChIKey of prop-2-enyl N'-propylcarbamimidothioate;hydrochloride?
The InChIKey is WUQMZGNAFVZOKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2S.ClH/c1-3-5-9-7(8)10-6-4-2;/h4H,2-3,5-6H2,1H3,(H2,8,9);1H.
What are the key properties of prop-2-enyl N'-propylcarbamimidothioate;hydrochloride?
prop-2-enyl N'-propylcarbamimidothioate;hydrochloride has a molecular weight of 194.73 g/mol, XLogP of 2.05, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl N'-propylcarbamimidothioate;hydrochloride is sourced from PubChem (CID 130978662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).