C7H14N2 — CID 123737533
N-ethenyl-N'-propylethanimidamide (PubChem CID 123737533) has the molecular formula C7H14N2 and a molecular weight of 126.20 g/mol. Its IUPAC name is N-ethenyl-N'-propylethanimidamide.
| Compound Name | N-ethenyl-N'-propylethanimidamide |
|---|---|
| PubChem CID | 123737533 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | N-ethenyl-N'-propylethanimidamide |
| SMILES | C=CN/C(C)=N/CCC |
| InChI | InChI=1S/C7H14N2/c1-4-6-9-7(3)8-5-2/h5H,2,4,6H2,1,3H3,(H,8,9) |
| InChIKey | PFIPGCYIVWUSPS-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|