C11H23N3 — CID 141286061
1,1-diethyl-3-prop-1-enyl-2-propylguanidine (PubChem CID 141286061) has the molecular formula C11H23N3 and a molecular weight of 197.33 g/mol. Its IUPAC name is 1,1-diethyl-3-prop-1-enyl-2-propylguanidine.
| Compound Name | 1,1-diethyl-3-prop-1-enyl-2-propylguanidine |
|---|---|
| PubChem CID | 141286061 |
| Molecular Formula | C11H23N3 |
| Molecular Weight | 197.33 g/mol |
| Exact Mass | 197.19 |
| IUPAC Name | 1,1-diethyl-3-prop-1-enyl-2-propylguanidine |
| SMILES | CC=CN/C(=N/CCC)N(CC)CC |
| InChI | InChI=1S/C11H23N3/c1-5-9-12-11(13-10-6-2)14(7-3)8-4/h5,9H,6-8,10H2,1-4H3,(H,12,13) |
| InChIKey | VESKDTKEUZKOTH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|