C12H28N4O2 — CID 104888011
3-amino-1,1-bis(2-ethoxyethyl)-2-propylguanidine (PubChem CID 104888011) has the molecular formula C12H28N4O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is 3-amino-1,1-bis(2-ethoxyethyl)-2-propylguanidine.
| Compound Name | 3-amino-1,1-bis(2-ethoxyethyl)-2-propylguanidine |
|---|---|
| PubChem CID | 104888011 |
| Molecular Formula | C12H28N4O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.22 |
| IUPAC Name | 3-amino-1,1-bis(2-ethoxyethyl)-2-propylguanidine |
| SMILES | CCC/N=C(/NN)N(CCOCC)CCOCC |
| InChI | InChI=1S/C12H28N4O2/c1-4-7-14-12(15-13)16(8-10-17-5-2)9-11-18-6-3/h4-11,13H2,1-3H3,(H,14,15) |
| InChIKey | LDNMPUWXBLZPTK-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|