C12H28N4O — CID 104883379
3-amino-2-(3-ethoxypropyl)-1,1-dipropylguanidine (PubChem CID 104883379) has the molecular formula C12H28N4O and a molecular weight of 244.38 g/mol. Its IUPAC name is 3-amino-2-(3-ethoxypropyl)-1,1-dipropylguanidine.
| Compound Name | 3-amino-2-(3-ethoxypropyl)-1,1-dipropylguanidine |
|---|---|
| PubChem CID | 104883379 |
| Molecular Formula | C12H28N4O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.23 |
| IUPAC Name | 3-amino-2-(3-ethoxypropyl)-1,1-dipropylguanidine |
| SMILES | CCCN(CCC)/C(=N\CCCOCC)NN |
| InChI | InChI=1S/C12H28N4O/c1-4-9-16(10-5-2)12(15-13)14-8-7-11-17-6-3/h4-11,13H2,1-3H3,(H,14,15) |
| InChIKey | DJOWXIGQVMYWQE-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|