C12H28N4O3 — CID 104884958
3-amino-1-(2-methoxyethyl)-1,2-bis(3-methoxypropyl)guanidine (PubChem CID 104884958) has the molecular formula C12H28N4O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is 3-amino-1-(2-methoxyethyl)-1,2-bis(3-methoxypropyl)guanidine.
| Compound Name | 3-amino-1-(2-methoxyethyl)-1,2-bis(3-methoxypropyl)guanidine |
|---|---|
| PubChem CID | 104884958 |
| Molecular Formula | C12H28N4O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | 3-amino-1-(2-methoxyethyl)-1,2-bis(3-methoxypropyl)guanidine |
| SMILES | COCCC/N=C(/NN)N(CCCOC)CCOC |
| InChI | InChI=1S/C12H28N4O3/c1-17-9-4-6-14-12(15-13)16(8-11-19-3)7-5-10-18-2/h4-11,13H2,1-3H3,(H,14,15) |
| InChIKey | XYVZBTNSMZXAPF-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|