C10H24N4O3 — CID 104885360
3-amino-1,1,2-tris(2-methoxyethyl)guanidine (PubChem CID 104885360) has the molecular formula C10H24N4O3 and a molecular weight of 248.33 g/mol. Its IUPAC name is 3-amino-1,1,2-tris(2-methoxyethyl)guanidine.
| Compound Name | 3-amino-1,1,2-tris(2-methoxyethyl)guanidine |
|---|---|
| PubChem CID | 104885360 |
| Molecular Formula | C10H24N4O3 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | 3-amino-1,1,2-tris(2-methoxyethyl)guanidine |
| SMILES | COCC/N=C(/NN)N(CCOC)CCOC |
| InChI | InChI=1S/C10H24N4O3/c1-15-7-4-12-10(13-11)14(5-8-16-2)6-9-17-3/h4-9,11H2,1-3H3,(H,12,13) |
| InChIKey | WYXUYIHOYYKJFQ-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|