About 3-amino-2-cyclopropyl-1,1-bis(2-methoxyethyl)guanidine
3-amino-2-cyclopropyl-1,1-bis(2-methoxyethyl)guanidine (PubChem CID 104885359) has the molecular formula C10H22N4O2
and a molecular weight of 230.31 g/mol. Its IUPAC name is 3-amino-2-cyclopropyl-1,1-bis(2-methoxyethyl)guanidine.
Molecular Properties
| Compound Name | 3-amino-2-cyclopropyl-1,1-bis(2-methoxyethyl)guanidine |
| PubChem CID | 104885359 |
| Molecular Formula | C10H22N4O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | 3-amino-2-cyclopropyl-1,1-bis(2-methoxyethyl)guanidine |
| SMILES | COCCN(CCOC)/C(=N/C1CC1)NN |
| InChI | InChI=1S/C10H22N4O2/c1-15-7-5-14(6-8-16-2)10(13-11)12-9-3-4-9/h9H,3-8,11H2,1-2H3,(H,12,13) |
| InChIKey | YUBLQONSFAGUCS-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-2-cyclopropyl-1,1-bis(2-methoxyethyl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-cyclopropyl-1,1-bis(2-methoxyethyl)guanidine?
The IUPAC name of 3-amino-2-cyclopropyl-1,1-bis(2-methoxyethyl)guanidine (CID 104885359) is 3-amino-2-cyclopropyl-1,1-bis(2-methoxyethyl)guanidine.
What is the SMILES notation for 3-amino-2-cyclopropyl-1,1-bis(2-methoxyethyl)guanidine?
The canonical SMILES for 3-amino-2-cyclopropyl-1,1-bis(2-methoxyethyl)guanidine is COCCN(CCOC)/C(=N/C1CC1)NN.
What is the InChIKey of 3-amino-2-cyclopropyl-1,1-bis(2-methoxyethyl)guanidine?
The InChIKey is YUBLQONSFAGUCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N4O2/c1-15-7-5-14(6-8-16-2)10(13-11)12-9-3-4-9/h9H,3-8,11H2,1-2H3,(H,12,13).
What are the key properties of 3-amino-2-cyclopropyl-1,1-bis(2-methoxyethyl)guanidine?
3-amino-2-cyclopropyl-1,1-bis(2-methoxyethyl)guanidine has a molecular weight of 230.31 g/mol, XLogP of -0.44, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-cyclopropyl-1,1-bis(2-methoxyethyl)guanidine is sourced from PubChem (CID 104885359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).