About N-[(Z)-1,3-diamino-4-methylpent-2-enylidene]formamide
N-[(Z)-1,3-diamino-4-methylpent-2-enylidene]formamide (PubChem CID 176713937) has the molecular formula C7H13N3O
and a molecular weight of 155.20 g/mol. Its IUPAC name is N-[(Z)-1,3-diamino-4-methylpent-2-enylidene]formamide.
Molecular Properties
| Compound Name | N-[(Z)-1,3-diamino-4-methylpent-2-enylidene]formamide |
| PubChem CID | 176713937 |
| Molecular Formula | C7H13N3O |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | N-[(Z)-1,3-diamino-4-methylpent-2-enylidene]formamide |
| SMILES | CC(C)/C(N)=C/C(N)=N/C=O |
| InChI | InChI=1S/C7H13N3O/c1-5(2)6(8)3-7(9)10-4-11/h3-5H,8H2,1-2H3,(H2,9,10,11)/b6-3- |
| InChIKey | RTOGSGGGIXLWEJ-UTCJRWHESA-N |
| XLogP | -0.00 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-1,3-diamino-4-methylpent-2-enylidene]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-1,3-diamino-4-methylpent-2-enylidene]formamide?
The IUPAC name of N-[(Z)-1,3-diamino-4-methylpent-2-enylidene]formamide (CID 176713937) is N-[(Z)-1,3-diamino-4-methylpent-2-enylidene]formamide.
What is the SMILES notation for N-[(Z)-1,3-diamino-4-methylpent-2-enylidene]formamide?
The canonical SMILES for N-[(Z)-1,3-diamino-4-methylpent-2-enylidene]formamide is CC(C)/C(N)=C/C(N)=N/C=O.
What is the InChIKey of N-[(Z)-1,3-diamino-4-methylpent-2-enylidene]formamide?
The InChIKey is RTOGSGGGIXLWEJ-UTCJRWHESA-N. The full InChI is InChI=1S/C7H13N3O/c1-5(2)6(8)3-7(9)10-4-11/h3-5H,8H2,1-2H3,(H2,9,10,11)/b6-3-.
What are the key properties of N-[(Z)-1,3-diamino-4-methylpent-2-enylidene]formamide?
N-[(Z)-1,3-diamino-4-methylpent-2-enylidene]formamide has a molecular weight of 155.20 g/mol, XLogP of -0.00, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-1,3-diamino-4-methylpent-2-enylidene]formamide is sourced from PubChem (CID 176713937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).