About formylazanide;2-methylpropanoylazanide;yttrium(3+)
formylazanide;2-methylpropanoylazanide;yttrium(3+) (PubChem CID 87732960) has the molecular formula C6H12N3O3Y
and a molecular weight of 263.09 g/mol. Its IUPAC name is formylazanide;2-methylpropanoylazanide;yttrium(3+).
Molecular Properties
| Compound Name | formylazanide;2-methylpropanoylazanide;yttrium(3+) |
| PubChem CID | 87732960 |
| Molecular Formula | C6H12N3O3Y |
| Molecular Weight | 263.09 g/mol |
| Exact Mass | 262.99 |
| IUPAC Name | formylazanide;2-methylpropanoylazanide;yttrium(3+) |
| SMILES | CC(C)C([NH-])=O.[NH-]C=O.[NH-]C=O.[Y+3] |
| InChI | InChI=1S/C4H9NO.2CH3NO.Y/c1-3(2)4(5)6;2*2-1-3;/h3H,1-2H3,(H2,5,6);2*1H,(H2,2,3);/q;;;+3/p-3 |
| InChIKey | MEOCNMLDSTVZRP-UHFFFAOYSA-K |
| XLogP | 1.61 |
| TPSA | 122.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.09 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze formylazanide;2-methylpropanoylazanide;yttrium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formylazanide;2-methylpropanoylazanide;yttrium(3+)?
The IUPAC name of formylazanide;2-methylpropanoylazanide;yttrium(3+) (CID 87732960) is formylazanide;2-methylpropanoylazanide;yttrium(3+).
What is the SMILES notation for formylazanide;2-methylpropanoylazanide;yttrium(3+)?
The canonical SMILES for formylazanide;2-methylpropanoylazanide;yttrium(3+) is CC(C)C([NH-])=O.[NH-]C=O.[NH-]C=O.[Y+3].
What is the InChIKey of formylazanide;2-methylpropanoylazanide;yttrium(3+)?
The InChIKey is MEOCNMLDSTVZRP-UHFFFAOYSA-K. The full InChI is InChI=1S/C4H9NO.2CH3NO.Y/c1-3(2)4(5)6;2*2-1-3;/h3H,1-2H3,(H2,5,6);2*1H,(H2,2,3);/q;;;+3/p-3.
What are the key properties of formylazanide;2-methylpropanoylazanide;yttrium(3+)?
formylazanide;2-methylpropanoylazanide;yttrium(3+) has a molecular weight of 263.09 g/mol, XLogP of 1.61, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for formylazanide;2-methylpropanoylazanide;yttrium(3+) is sourced from PubChem (CID 87732960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).