About 2-methylpropanoylazanide;propanoylazanide;yttrium
2-methylpropanoylazanide;propanoylazanide;yttrium (PubChem CID 87733008) has the molecular formula C7H14N2O2Y-2
and a molecular weight of 247.11 g/mol. Its IUPAC name is 2-methylpropanoylazanide;propanoylazanide;yttrium.
Molecular Properties
| Compound Name | 2-methylpropanoylazanide;propanoylazanide;yttrium |
| PubChem CID | 87733008 |
| Molecular Formula | C7H14N2O2Y-2 |
| Molecular Weight | 247.11 g/mol |
| Exact Mass | 247.01 |
| IUPAC Name | 2-methylpropanoylazanide;propanoylazanide;yttrium |
| SMILES | CC(C)C([NH-])=O.CCC([NH-])=O.[Y] |
| InChI | InChI=1S/C4H9NO.C3H7NO.Y/c1-3(2)4(5)6;1-2-3(4)5;/h3H,1-2H3,(H2,5,6);2H2,1H3,(H2,4,5);/p-2 |
| InChIKey | ZXYSCVULNPEPOL-UHFFFAOYSA-L |
| XLogP | 2.19 |
| TPSA | 81.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.11 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylpropanoylazanide;propanoylazanide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropanoylazanide;propanoylazanide;yttrium?
The IUPAC name of 2-methylpropanoylazanide;propanoylazanide;yttrium (CID 87733008) is 2-methylpropanoylazanide;propanoylazanide;yttrium.
What is the SMILES notation for 2-methylpropanoylazanide;propanoylazanide;yttrium?
The canonical SMILES for 2-methylpropanoylazanide;propanoylazanide;yttrium is CC(C)C([NH-])=O.CCC([NH-])=O.[Y].
What is the InChIKey of 2-methylpropanoylazanide;propanoylazanide;yttrium?
The InChIKey is ZXYSCVULNPEPOL-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H9NO.C3H7NO.Y/c1-3(2)4(5)6;1-2-3(4)5;/h3H,1-2H3,(H2,5,6);2H2,1H3,(H2,4,5);/p-2.
What are the key properties of 2-methylpropanoylazanide;propanoylazanide;yttrium?
2-methylpropanoylazanide;propanoylazanide;yttrium has a molecular weight of 247.11 g/mol, XLogP of 2.19, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropanoylazanide;propanoylazanide;yttrium is sourced from PubChem (CID 87733008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).