About propanoylazanide;rhenium
propanoylazanide;rhenium (PubChem CID 155738125) has the molecular formula C3H6NORe-
and a molecular weight of 258.29 g/mol. Its IUPAC name is propanoylazanide;rhenium.
Molecular Properties
| Compound Name | propanoylazanide;rhenium |
| PubChem CID | 155738125 |
| Molecular Formula | C3H6NORe- |
| Molecular Weight | 258.29 g/mol |
| Exact Mass | 259.00 |
| IUPAC Name | propanoylazanide;rhenium |
| SMILES | CCC([NH-])=O.[Re] |
| InChI | InChI=1S/C3H7NO.Re/c1-2-3(4)5;/h2H2,1H3,(H2,4,5);/p-1 |
| InChIKey | PWXFSQCQSGDJJN-UHFFFAOYSA-M |
| XLogP | 0.97 |
| TPSA | 40.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.29 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze propanoylazanide;rhenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propanoylazanide;rhenium?
The IUPAC name of propanoylazanide;rhenium (CID 155738125) is propanoylazanide;rhenium.
What is the SMILES notation for propanoylazanide;rhenium?
The canonical SMILES for propanoylazanide;rhenium is CCC([NH-])=O.[Re].
What is the InChIKey of propanoylazanide;rhenium?
The InChIKey is PWXFSQCQSGDJJN-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H7NO.Re/c1-2-3(4)5;/h2H2,1H3,(H2,4,5);/p-1.
What are the key properties of propanoylazanide;rhenium?
propanoylazanide;rhenium has a molecular weight of 258.29 g/mol, XLogP of 0.97, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for propanoylazanide;rhenium is sourced from PubChem (CID 155738125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).