About butanoylazanide;neodymium
butanoylazanide;neodymium (PubChem CID 87732529) has the molecular formula C4H8NNdO-
and a molecular weight of 230.35 g/mol. Its IUPAC name is butanoylazanide;neodymium.
Molecular Properties
| Compound Name | butanoylazanide;neodymium |
| PubChem CID | 87732529 |
| Molecular Formula | C4H8NNdO- |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 227.97 |
| IUPAC Name | butanoylazanide;neodymium |
| SMILES | CCCC([NH-])=O.[Nd] |
| InChI | InChI=1S/C4H9NO.Nd/c1-2-3-4(5)6;/h2-3H2,1H3,(H2,5,6);/p-1 |
| InChIKey | ITSVHRPBEKBQCU-UHFFFAOYSA-M |
| XLogP | 1.37 |
| TPSA | 40.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze butanoylazanide;neodymium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanoylazanide;neodymium?
The IUPAC name of butanoylazanide;neodymium (CID 87732529) is butanoylazanide;neodymium.
What is the SMILES notation for butanoylazanide;neodymium?
The canonical SMILES for butanoylazanide;neodymium is CCCC([NH-])=O.[Nd].
What is the InChIKey of butanoylazanide;neodymium?
The InChIKey is ITSVHRPBEKBQCU-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H9NO.Nd/c1-2-3-4(5)6;/h2-3H2,1H3,(H2,5,6);/p-1.
What are the key properties of butanoylazanide;neodymium?
butanoylazanide;neodymium has a molecular weight of 230.35 g/mol, XLogP of 1.37, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butanoylazanide;neodymium is sourced from PubChem (CID 87732529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).