About sodium hexanoylazanide
sodium hexanoylazanide (PubChem CID 88638958) has the molecular formula C6H12NNaO
and a molecular weight of 137.16 g/mol. Its IUPAC name is sodium hexanoylazanide.
Molecular Properties
| Compound Name | sodium hexanoylazanide |
| PubChem CID | 88638958 |
| Molecular Formula | C6H12NNaO |
| Molecular Weight | 137.16 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | sodium hexanoylazanide |
| SMILES | CCCCCC([NH-])=O.[Na+] |
| InChI | InChI=1S/C6H13NO.Na/c1-2-3-4-5-6(7)8;/h2-5H2,1H3,(H2,7,8);/q;+1/p-1 |
| InChIKey | VAUJKEZCPRRITE-UHFFFAOYSA-M |
| XLogP | -0.85 |
| TPSA | 40.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.16 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze sodium hexanoylazanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium hexanoylazanide?
The IUPAC name of sodium hexanoylazanide (CID 88638958) is sodium hexanoylazanide.
What is the SMILES notation for sodium hexanoylazanide?
The canonical SMILES for sodium hexanoylazanide is CCCCCC([NH-])=O.[Na+].
What is the InChIKey of sodium hexanoylazanide?
The InChIKey is VAUJKEZCPRRITE-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H13NO.Na/c1-2-3-4-5-6(7)8;/h2-5H2,1H3,(H2,7,8);/q;+1/p-1.
What are the key properties of sodium hexanoylazanide?
sodium hexanoylazanide has a molecular weight of 137.16 g/mol, XLogP of -0.85, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium hexanoylazanide is sourced from PubChem (CID 88638958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).